C9H12N2O3 — CID 98511096
(1R,2S,3R,6S,7R,9R)-2-hydroxy-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxamide (PubChem CID 98511096) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is (1R,2S,3R,6S,7R,9R)-2-hydroxy-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxamide.
| Compound Name | (1R,2S,3R,6S,7R,9R)-2-hydroxy-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxamide |
|---|---|
| PubChem CID | 98511096 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1R,2S,3R,6S,7R,9R)-2-hydroxy-5-oxo-4-azatricyclo[4.2.1.03,7]nonane-9-carboxamide |
| SMILES | NC(=O)[C@@H]1[C@H]2C[C@H]3[C@@H](NC(=O)[C@@H]31)[C@H]2O |
| InChI | InChI=1S/C9H12N2O3/c10-8(13)4-3-1-2-5(4)9(14)11-6(2)7(3)12/h2-7,12H,1H2,(H2,10,13)(H,11,14)/t2-,3-,4-,5+,6-,7+/m1/s1 |
| InChIKey | JTKFSGSSUANNRH-VXGWJHEQSA-N |
| XLogP | -1.79 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |