C15H14Cl2NOP — CID 98534487
N-dichlorophosphoryl-N-methyl-4-[(Z)-2-phenylethenyl]aniline (PubChem CID 98534487) has the molecular formula C15H14Cl2NOP and a molecular weight of 326.16 g/mol. Its IUPAC name is N-dichlorophosphoryl-N-methyl-4-[(Z)-2-phenylethenyl]aniline.
| Compound Name | N-dichlorophosphoryl-N-methyl-4-[(Z)-2-phenylethenyl]aniline |
|---|---|
| PubChem CID | 98534487 |
| Molecular Formula | C15H14Cl2NOP |
| Molecular Weight | 326.16 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | N-dichlorophosphoryl-N-methyl-4-[(Z)-2-phenylethenyl]aniline |
| SMILES | CN(c1ccc(/C=C\c2ccccc2)cc1)P(=O)(Cl)Cl |
| InChI | InChI=1S/C15H14Cl2NOP/c1-18(20(16,17)19)15-11-9-14(10-12-15)8-7-13-5-3-2-4-6-13/h2-12H,1H3/b8-7- |
| InChIKey | XKRWQTUWHMAIIC-FPLPWBNLSA-N |
| XLogP | 5.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.16 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|