C18H18BrN3O — CID 98537461
1-[(Z)-[(1R,2S,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-3-phenylurea (PubChem CID 98537461) has the molecular formula C18H18BrN3O and a molecular weight of 372.27 g/mol. Its IUPAC name is 1-[(Z)-[(1R,2S,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-3-phenylurea.
| Compound Name | 1-[(Z)-[(1R,2S,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-3-phenylurea |
|---|---|
| PubChem CID | 98537461 |
| Molecular Formula | C18H18BrN3O |
| Molecular Weight | 372.27 g/mol |
| Exact Mass | 371.06 |
| IUPAC Name | 1-[(Z)-[(1R,2S,3S,5S,6R,7S,8R,9R,10R)-7-bromo-4-pentacyclo[6.3.0.02,6.03,10.05,9]undecanylidene]amino]-3-phenylurea |
| SMILES | O=C(N/N=C1\[C@H]2[C@H]3[C@H]4C[C@H]5[C@H]3[C@H](Br)[C@@H]2[C@@H]5[C@@H]14)Nc1ccccc1 |
| InChI | InChI=1S/C18H18BrN3O/c19-16-12-8-6-9-10(12)15-14(16)11(8)13(9)17(15)21-22-18(23)20-7-4-2-1-3-5-7/h1-5,8-16H,6H2,(H2,20,22,23)/b21-17-/t8-,9-,10+,11+,12-,13+,14-,15+,16+/m1/s1 |
| InChIKey | FBZBNONCKRZHGH-BJYVEBSWSA-N |
| XLogP | 3.32 |
| TPSA | 53.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.27 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|