C14H24O3 — CID 98538924
(1R,5S,6R)-1,3,3-trimethyl-5-[(2R)-oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptane (PubChem CID 98538924) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1R,5S,6R)-1,3,3-trimethyl-5-[(2R)-oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptane.
| Compound Name | (1R,5S,6R)-1,3,3-trimethyl-5-[(2R)-oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptane |
|---|---|
| PubChem CID | 98538924 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1R,5S,6R)-1,3,3-trimethyl-5-[(2R)-oxan-2-yl]oxy-7-oxabicyclo[4.1.0]heptane |
| SMILES | CC1(C)C[C@H](O[C@@H]2CCCCO2)[C@H]2O[C@]2(C)C1 |
| InChI | InChI=1S/C14H24O3/c1-13(2)8-10(12-14(3,9-13)17-12)16-11-6-4-5-7-15-11/h10-12H,4-9H2,1-3H3/t10-,11+,12+,14+/m0/s1 |
| InChIKey | FZQIFZSZUOJRQD-FMCLSXCISA-N |
| XLogP | 2.88 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|