C27H22O3 — CID 986612
2-[(2R)-4-oxo-2,4-diphenylbutyl]-6-phenylpyran-4-one (PubChem CID 986612) has the molecular formula C27H22O3 and a molecular weight of 394.47 g/mol. Its IUPAC name is 2-[(2R)-4-oxo-2,4-diphenylbutyl]-6-phenylpyran-4-one.
| Compound Name | 2-[(2R)-4-oxo-2,4-diphenylbutyl]-6-phenylpyran-4-one |
|---|---|
| PubChem CID | 986612 |
| Molecular Formula | C27H22O3 |
| Molecular Weight | 394.47 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 2-[(2R)-4-oxo-2,4-diphenylbutyl]-6-phenylpyran-4-one |
| SMILES | O=C(C[C@@H](Cc1cc(=O)cc(-c2ccccc2)o1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H22O3/c28-24-18-25(30-27(19-24)22-14-8-3-9-15-22)16-23(20-10-4-1-5-11-20)17-26(29)21-12-6-2-7-13-21/h1-15,18-19,23H,16-17H2/t23-/m1/s1 |
| InChIKey | DRQHSOBUZLKYBX-HSZRJFAPSA-N |
| XLogP | 5.91 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |