C22H22ClN3O2 — CID 98775878
[(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-chloro-1H-indol-2-yl)methanone (PubChem CID 98775878) has the molecular formula C22H22ClN3O2 and a molecular weight of 395.89 g/mol. Its IUPAC name is [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-chloro-1H-indol-2-yl)methanone.
| Compound Name | [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-chloro-1H-indol-2-yl)methanone |
|---|---|
| PubChem CID | 98775878 |
| Molecular Formula | C22H22ClN3O2 |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | [(4aR,7aR)-4-benzyl-2,3,4a,5,7,7a-hexahydropyrrolo[3,4-b][1,4]oxazin-6-yl]-(6-chloro-1H-indol-2-yl)methanone |
| SMILES | O=C(c1cc2ccc(Cl)cc2[nH]1)N1C[C@@H]2[C@@H](C1)OCCN2Cc1ccccc1 |
| InChI | InChI=1S/C22H22ClN3O2/c23-17-7-6-16-10-19(24-18(16)11-17)22(27)26-13-20-21(14-26)28-9-8-25(20)12-15-4-2-1-3-5-15/h1-7,10-11,20-21,24H,8-9,12-14H2/t20-,21-/m1/s1 |
| InChIKey | UDFXPFALALUPSA-NHCUHLMSSA-N |
| XLogP | 3.55 |
| TPSA | 48.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |