C16H23FN4O — CID 98777189
(3aS,6aR)-4-(5-fluoropyrimidin-2-yl)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole (PubChem CID 98777189) has the molecular formula C16H23FN4O and a molecular weight of 306.38 g/mol. Its IUPAC name is (3aS,6aR)-4-(5-fluoropyrimidin-2-yl)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole.
| Compound Name | (3aS,6aR)-4-(5-fluoropyrimidin-2-yl)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
|---|---|
| PubChem CID | 98777189 |
| Molecular Formula | C16H23FN4O |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | (3aS,6aR)-4-(5-fluoropyrimidin-2-yl)-1-(oxan-4-ylmethyl)-2,3,3a,5,6,6a-hexahydropyrrolo[3,2-b]pyrrole |
| SMILES | Fc1cnc(N2CC[C@@H]3[C@@H]2CCN3CC2CCOCC2)nc1 |
| InChI | InChI=1S/C16H23FN4O/c17-13-9-18-16(19-10-13)21-6-2-14-15(21)1-5-20(14)11-12-3-7-22-8-4-12/h9-10,12,14-15H,1-8,11H2/t14-,15+/m1/s1 |
| InChIKey | GQTWSXMQMGKQPK-CABCVRRESA-N |
| XLogP | 1.70 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |