C17H24N4S — CID 98777368
(2S,3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine (PubChem CID 98777368) has the molecular formula C17H24N4S and a molecular weight of 316.47 g/mol. Its IUPAC name is (2S,3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine.
| Compound Name | (2S,3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 98777368 |
| Molecular Formula | C17H24N4S |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (2S,3aR,7aS)-1-methyl-2-(pyrazol-1-ylmethyl)-5-(thiophen-3-ylmethyl)-3,3a,4,6,7,7a-hexahydro-2H-pyrrolo[3,2-c]pyridine |
| SMILES | CN1[C@H](Cn2cccn2)C[C@@H]2CN(Cc3ccsc3)CC[C@@H]21 |
| InChI | InChI=1S/C17H24N4S/c1-19-16(12-21-6-2-5-18-21)9-15-11-20(7-3-17(15)19)10-14-4-8-22-13-14/h2,4-6,8,13,15-17H,3,7,9-12H2,1H3/t15-,16+,17+/m1/s1 |
| InChIKey | CMQGTUCOSSQKHL-IKGGRYGDSA-N |
| XLogP | 2.54 |
| TPSA | 24.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |