C11H21N3O2S2 — CID 98785800
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(methanesulfonamido)ethyl]thiourea (PubChem CID 98785800) has the molecular formula C11H21N3O2S2 and a molecular weight of 291.44 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(methanesulfonamido)ethyl]thiourea.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(methanesulfonamido)ethyl]thiourea |
|---|---|
| PubChem CID | 98785800 |
| Molecular Formula | C11H21N3O2S2 |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-3-[2-(methanesulfonamido)ethyl]thiourea |
| SMILES | CS(=O)(=O)NCCNC(=S)N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C11H21N3O2S2/c1-18(15,16)13-5-4-12-11(17)14-10-7-8-2-3-9(10)6-8/h8-10,13H,2-7H2,1H3,(H2,12,14,17)/t8-,9-,10+/m0/s1 |
| InChIKey | VPOMQTGBYYQQQX-LPEHRKFASA-N |
| XLogP | 0.19 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|