C14H28N4O3S — CID 98791772
1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-[2-(methanesulfonamido)ethyl]-3-(2-methoxyethyl)guanidine (PubChem CID 98791772) has the molecular formula C14H28N4O3S and a molecular weight of 332.47 g/mol. Its IUPAC name is 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-[2-(methanesulfonamido)ethyl]-3-(2-methoxyethyl)guanidine.
| Compound Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-[2-(methanesulfonamido)ethyl]-3-(2-methoxyethyl)guanidine |
|---|---|
| PubChem CID | 98791772 |
| Molecular Formula | C14H28N4O3S |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 1-[(1S,2R,4S)-2-bicyclo[2.2.1]heptanyl]-2-[2-(methanesulfonamido)ethyl]-3-(2-methoxyethyl)guanidine |
| SMILES | COCCN/C(=N\CCNS(C)(=O)=O)N[C@@H]1C[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H28N4O3S/c1-21-8-7-16-14(15-5-6-17-22(2,19)20)18-13-10-11-3-4-12(13)9-11/h11-13,17H,3-10H2,1-2H3,(H2,15,16,18)/t11-,12-,13+/m0/s1 |
| InChIKey | UWZQQHJYYVNWFC-RWMBFGLXSA-N |
| XLogP | -0.09 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|