C16H23N3O2S2 — CID 18557108
1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(4-sulfamoylphenyl)ethyl]thiourea (PubChem CID 18557108) has the molecular formula C16H23N3O2S2 and a molecular weight of 353.51 g/mol. Its IUPAC name is 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(4-sulfamoylphenyl)ethyl]thiourea.
| Compound Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
|---|---|
| PubChem CID | 18557108 |
| Molecular Formula | C16H23N3O2S2 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.12 |
| IUPAC Name | 1-[(1R,2R,4R)-2-bicyclo[2.2.1]heptanyl]-3-[2-(4-sulfamoylphenyl)ethyl]thiourea |
| SMILES | NS(=O)(=O)c1ccc(CCNC(=S)N[C@@H]2C[C@@H]3CC[C@@H]2C3)cc1 |
| InChI | InChI=1S/C16H23N3O2S2/c17-23(20,21)14-5-2-11(3-6-14)7-8-18-16(22)19-15-10-12-1-4-13(15)9-12/h2-3,5-6,12-13,15H,1,4,7-10H2,(H2,17,20,21)(H2,18,19,22)/t12-,13-,15-/m1/s1 |
| InChIKey | NRSPOXZIUNTYIF-UMVBOHGHSA-N |
| XLogP | 1.53 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|