C16H21FN2O3S — CID 98810331
(5S,10S)-10-ethyl-9-(4-fluorophenyl)sulfonyl-1,9-diazaspiro[4.5]decan-2-one (PubChem CID 98810331) has the molecular formula C16H21FN2O3S and a molecular weight of 340.42 g/mol. Its IUPAC name is (5S,10S)-10-ethyl-9-(4-fluorophenyl)sulfonyl-1,9-diazaspiro[4.5]decan-2-one.
| Compound Name | (5S,10S)-10-ethyl-9-(4-fluorophenyl)sulfonyl-1,9-diazaspiro[4.5]decan-2-one |
|---|---|
| PubChem CID | 98810331 |
| Molecular Formula | C16H21FN2O3S |
| Molecular Weight | 340.42 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | (5S,10S)-10-ethyl-9-(4-fluorophenyl)sulfonyl-1,9-diazaspiro[4.5]decan-2-one |
| SMILES | CC[C@@H]1N(S(=O)(=O)c2ccc(F)cc2)CCC[C@]12CCC(=O)N2 |
| InChI | InChI=1S/C16H21FN2O3S/c1-2-14-16(10-8-15(20)18-16)9-3-11-19(14)23(21,22)13-6-4-12(17)5-7-13/h4-7,14H,2-3,8-11H2,1H3,(H,18,20)/t14-,16-/m0/s1 |
| InChIKey | IETMQZQVZQFCTJ-HOCLYGCPSA-N |
| XLogP | 2.04 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.42 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |