C22H31N3O3 — CID 98915175
1-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide (PubChem CID 98915175) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide.
| Compound Name | 1-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 98915175 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-[[(E)-3-(4-acetamidophenyl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(NC(=O)/C=C/c2ccc(NC(C)=O)cc2)CCCCC1 |
| InChI | InChI=1S/C22H31N3O3/c1-4-25(5-2)21(28)22(15-7-6-8-16-22)24-20(27)14-11-18-9-12-19(13-10-18)23-17(3)26/h9-14H,4-8,15-16H2,1-3H3,(H,23,26)(H,24,27)/b14-11+ |
| InChIKey | PZTKGMMSSDCXMR-SDNWHVSQSA-N |
| XLogP | 3.35 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|