C21H27N3O2S — CID 55982303
1-[[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide (PubChem CID 55982303) has the molecular formula C21H27N3O2S and a molecular weight of 385.53 g/mol. Its IUPAC name is 1-[[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide.
| Compound Name | 1-[[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 55982303 |
| Molecular Formula | C21H27N3O2S |
| Molecular Weight | 385.53 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | 1-[[(E)-3-(1,3-benzothiazol-2-yl)prop-2-enoyl]amino]-N,N-diethylcyclohexane-1-carboxamide |
| SMILES | CCN(CC)C(=O)C1(NC(=O)/C=C/c2nc3ccccc3s2)CCCCC1 |
| InChI | InChI=1S/C21H27N3O2S/c1-3-24(4-2)20(26)21(14-8-5-9-15-21)23-18(25)12-13-19-22-16-10-6-7-11-17(16)27-19/h6-7,10-13H,3-5,8-9,14-15H2,1-2H3,(H,23,25)/b13-12+ |
| InChIKey | BRSYGKJCIDMBOO-OUKQBFOZSA-N |
| XLogP | 4.00 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.53 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|