C37H29NO3S — CID 98924650
(4aR,6R)-4a-(4-methoxyphenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one (PubChem CID 98924650) has the molecular formula C37H29NO3S and a molecular weight of 567.71 g/mol. Its IUPAC name is (4aR,6R)-4a-(4-methoxyphenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one.
| Compound Name | (4aR,6R)-4a-(4-methoxyphenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
|---|---|
| PubChem CID | 98924650 |
| Molecular Formula | C37H29NO3S |
| Molecular Weight | 567.71 g/mol |
| Exact Mass | 567.19 |
| IUPAC Name | (4aR,6R)-4a-(4-methoxyphenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
| SMILES | COc1ccc([C@]23C[C@H](c4ccccc4)Sc4ccccc4N2C(=O)C(c2ccccc2)=C(c2ccccc2)O3)cc1 |
| InChI | InChI=1S/C37H29NO3S/c1-40-30-23-21-29(22-24-30)37-25-33(26-13-5-2-6-14-26)42-32-20-12-11-19-31(32)38(37)36(39)34(27-15-7-3-8-16-27)35(41-37)28-17-9-4-10-18-28/h2-24,33H,25H2,1H3/t33-,37-/m1/s1 |
| InChIKey | DUPFSXZQWHLYDA-PZSMLTKBSA-N |
| XLogP | 8.72 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.71 |
| LogP ≤ 5 | 8.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|