C36H26ClNO2S — CID 45034659
4a-(4-chlorophenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one (PubChem CID 45034659) has the molecular formula C36H26ClNO2S and a molecular weight of 572.13 g/mol. Its IUPAC name is 4a-(4-chlorophenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one.
| Compound Name | 4a-(4-chlorophenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
|---|---|
| PubChem CID | 45034659 |
| Molecular Formula | C36H26ClNO2S |
| Molecular Weight | 572.13 g/mol |
| Exact Mass | 571.14 |
| IUPAC Name | 4a-(4-chlorophenyl)-2,3,6-triphenyl-5,6-dihydro-[1,3]oxazino[2,3-d][1,5]benzothiazepin-1-one |
| SMILES | O=C1C(c2ccccc2)=C(c2ccccc2)OC2(c3ccc(Cl)cc3)CC(c3ccccc3)Sc3ccccc3N12 |
| InChI | InChI=1S/C36H26ClNO2S/c37-29-22-20-28(21-23-29)36-24-32(25-12-4-1-5-13-25)41-31-19-11-10-18-30(31)38(36)35(39)33(26-14-6-2-7-15-26)34(40-36)27-16-8-3-9-17-27/h1-23,32H,24H2 |
| InChIKey | SFEVMPQLMYXJAT-UHFFFAOYSA-N |
| XLogP | 9.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.13 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|