C31H26Cl2N2O2 — CID 99129240
(2R)-2-chloro-N-[4-[9-[4-[[(2R)-2-chloropropanoyl]amino]phenyl]fluoren-9-yl]phenyl]propanamide (PubChem CID 99129240) has the molecular formula C31H26Cl2N2O2 and a molecular weight of 529.47 g/mol. Its IUPAC name is (2R)-2-chloro-N-[4-[9-[4-[[(2R)-2-chloropropanoyl]amino]phenyl]fluoren-9-yl]phenyl]propanamide.
| Compound Name | (2R)-2-chloro-N-[4-[9-[4-[[(2R)-2-chloropropanoyl]amino]phenyl]fluoren-9-yl]phenyl]propanamide |
|---|---|
| PubChem CID | 99129240 |
| Molecular Formula | C31H26Cl2N2O2 |
| Molecular Weight | 529.47 g/mol |
| Exact Mass | 528.14 |
| IUPAC Name | (2R)-2-chloro-N-[4-[9-[4-[[(2R)-2-chloropropanoyl]amino]phenyl]fluoren-9-yl]phenyl]propanamide |
| SMILES | C[C@@H](Cl)C(=O)Nc1ccc(C2(c3ccc(NC(=O)[C@@H](C)Cl)cc3)c3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C31H26Cl2N2O2/c1-19(32)29(36)34-23-15-11-21(12-16-23)31(22-13-17-24(18-14-22)35-30(37)20(2)33)27-9-5-3-7-25(27)26-8-4-6-10-28(26)31/h3-20H,1-2H3,(H,34,36)(H,35,37)/t19-,20-/m1/s1 |
| InChIKey | FGCLSABFJGZVSV-WOJBJXKFSA-N |
| XLogP | 7.18 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.47 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|