C18H16ClN3O3S — CID 992005
2-chloro-3-[(3R)-5-(furan-2-yl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-7-methylquinoline (PubChem CID 992005) has the molecular formula C18H16ClN3O3S and a molecular weight of 389.86 g/mol. Its IUPAC name is 2-chloro-3-[(3R)-5-(furan-2-yl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-7-methylquinoline.
| Compound Name | 2-chloro-3-[(3R)-5-(furan-2-yl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-7-methylquinoline |
|---|---|
| PubChem CID | 992005 |
| Molecular Formula | C18H16ClN3O3S |
| Molecular Weight | 389.86 g/mol |
| Exact Mass | 389.06 |
| IUPAC Name | 2-chloro-3-[(3R)-5-(furan-2-yl)-2-methylsulfonyl-3,4-dihydropyrazol-3-yl]-7-methylquinoline |
| SMILES | Cc1ccc2cc([C@H]3CC(c4ccco4)=NN3S(C)(=O)=O)c(Cl)nc2c1 |
| InChI | InChI=1S/C18H16ClN3O3S/c1-11-5-6-12-9-13(18(19)20-14(12)8-11)16-10-15(17-4-3-7-25-17)21-22(16)26(2,23)24/h3-9,16H,10H2,1-2H3/t16-/m1/s1 |
| InChIKey | ZWNMTGDJVLSHBG-MRXNPFEDSA-N |
| XLogP | 3.90 |
| TPSA | 75.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.86 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|