C19H23N3O4 — CID 99579980
N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide (PubChem CID 99579980) has the molecular formula C19H23N3O4 and a molecular weight of 357.41 g/mol. Its IUPAC name is N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide.
| Compound Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide |
|---|---|
| PubChem CID | 99579980 |
| Molecular Formula | C19H23N3O4 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.17 |
| IUPAC Name | N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2-(1-oxidopyridin-1-ium-2-yl)oxyacetamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)COc3cccc[n+]3[O-])cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H23N3O4/c1-14-11-21(12-15(2)26-14)17-8-6-16(7-9-17)20-18(23)13-25-19-5-3-4-10-22(19)24/h3-10,14-15H,11-13H2,1-2H3,(H,20,23)/t14-,15+ |
| InChIKey | QWCOVLDKTBQDQT-GASCZTMLSA-N |
| XLogP | 1.95 |
| TPSA | 77.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|