C17H25N3O3S — CID 71046184
3-[2-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-oxoethyl]sulfanylpropanamide (PubChem CID 71046184) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is 3-[2-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-oxoethyl]sulfanylpropanamide.
| Compound Name | 3-[2-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-oxoethyl]sulfanylpropanamide |
|---|---|
| PubChem CID | 71046184 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 3-[2-[4-(2,6-dimethylmorpholin-4-yl)anilino]-2-oxoethyl]sulfanylpropanamide |
| SMILES | CC1CN(c2ccc(NC(=O)CSCCC(N)=O)cc2)CC(C)O1 |
| InChI | InChI=1S/C17H25N3O3S/c1-12-9-20(10-13(2)23-12)15-5-3-14(4-6-15)19-17(22)11-24-8-7-16(18)21/h3-6,12-13H,7-11H2,1-2H3,(H2,18,21)(H,19,22) |
| InChIKey | LMNRKZHPFTWBJK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 84.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|