C18H21N3OS — CID 99641127
(5Z)-3,3-dimethyl-5-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]cyclohexan-1-one (PubChem CID 99641127) has the molecular formula C18H21N3OS and a molecular weight of 327.45 g/mol. Its IUPAC name is (5Z)-3,3-dimethyl-5-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]cyclohexan-1-one.
| Compound Name | (5Z)-3,3-dimethyl-5-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]cyclohexan-1-one |
|---|---|
| PubChem CID | 99641127 |
| Molecular Formula | C18H21N3OS |
| Molecular Weight | 327.45 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | (5Z)-3,3-dimethyl-5-[[4-(4-methylphenyl)-1,3-thiazol-2-yl]hydrazinylidene]cyclohexan-1-one |
| SMILES | Cc1ccc(-c2csc(N/N=C3\CC(=O)CC(C)(C)C3)n2)cc1 |
| InChI | InChI=1S/C18H21N3OS/c1-12-4-6-13(7-5-12)16-11-23-17(19-16)21-20-14-8-15(22)10-18(2,3)9-14/h4-7,11H,8-10H2,1-3H3,(H,19,21)/b20-14+ |
| InChIKey | XAHIMLBWKGXLOL-XSFVSMFZSA-N |
| XLogP | 4.67 |
| TPSA | 54.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.45 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|