C38H34Cl5N3O8S — CID 99653676
benzyl (2S)-5-[[(2R)-3-benzylsulfanyl-1-oxo-1-[[2-oxo-2-(2,3,4,5,6-pentachlorophenoxy)ethyl]amino]propan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate (PubChem CID 99653676) has the molecular formula C38H34Cl5N3O8S and a molecular weight of 870.03 g/mol. Its IUPAC name is benzyl (2S)-5-[[(2R)-3-benzylsulfanyl-1-oxo-1-[[2-oxo-2-(2,3,4,5,6-pentachlorophenoxy)ethyl]amino]propan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate.
| Compound Name | benzyl (2S)-5-[[(2R)-3-benzylsulfanyl-1-oxo-1-[[2-oxo-2-(2,3,4,5,6-pentachlorophenoxy)ethyl]amino]propan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
|---|---|
| PubChem CID | 99653676 |
| Molecular Formula | C38H34Cl5N3O8S |
| Molecular Weight | 870.03 g/mol |
| Exact Mass | 867.05 |
| IUPAC Name | benzyl (2S)-5-[[(2R)-3-benzylsulfanyl-1-oxo-1-[[2-oxo-2-(2,3,4,5,6-pentachlorophenoxy)ethyl]amino]propan-2-yl]amino]-5-oxo-2-(phenylmethoxycarbonylamino)pentanoate |
| SMILES | O=C(CC[C@H](NC(=O)OCc1ccccc1)C(=O)OCc1ccccc1)N[C@@H](CSCc1ccccc1)C(=O)NCC(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C38H34Cl5N3O8S/c39-30-31(40)33(42)35(34(43)32(30)41)54-29(48)18-44-36(49)27(22-55-21-25-14-8-3-9-15-25)45-28(47)17-16-26(37(50)52-19-23-10-4-1-5-11-23)46-38(51)53-20-24-12-6-2-7-13-24/h1-15,26-27H,16-22H2,(H,44,49)(H,45,47)(H,46,51)/t26-,27-/m0/s1 |
| InChIKey | DTMGTYRWLKQYGV-SVBPBHIXSA-N |
| XLogP | 8.21 |
| TPSA | 149.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 870.03 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|