C28H24Cl5N3O6 — CID 23318241
(2,3,4,5,6-pentachlorophenyl) 2-[2-[N-[2-(phenylmethoxycarbonylamino)propanoyl]anilino]propanoylamino]acetate (PubChem CID 23318241) has the molecular formula C28H24Cl5N3O6 and a molecular weight of 675.78 g/mol. Its IUPAC name is (2,3,4,5,6-pentachlorophenyl) 2-[2-[N-[2-(phenylmethoxycarbonylamino)propanoyl]anilino]propanoylamino]acetate.
| Compound Name | (2,3,4,5,6-pentachlorophenyl) 2-[2-[N-[2-(phenylmethoxycarbonylamino)propanoyl]anilino]propanoylamino]acetate |
|---|---|
| PubChem CID | 23318241 |
| Molecular Formula | C28H24Cl5N3O6 |
| Molecular Weight | 675.78 g/mol |
| Exact Mass | 673.01 |
| IUPAC Name | (2,3,4,5,6-pentachlorophenyl) 2-[2-[N-[2-(phenylmethoxycarbonylamino)propanoyl]anilino]propanoylamino]acetate |
| SMILES | CC(NC(=O)OCc1ccccc1)C(=O)N(c1ccccc1)C(C)C(=O)NCC(=O)Oc1c(Cl)c(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C28H24Cl5N3O6/c1-15(35-28(40)41-14-17-9-5-3-6-10-17)27(39)36(18-11-7-4-8-12-18)16(2)26(38)34-13-19(37)42-25-23(32)21(30)20(29)22(31)24(25)33/h3-12,15-16H,13-14H2,1-2H3,(H,34,38)(H,35,40) |
| InChIKey | BSYQKVUYJHEBMM-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 675.78 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|