C19H15F3N4O2 — CID 99717806
3-[[(4R)-2,5-dioxo-4-phenyl-4-(trifluoromethyl)imidazolidin-1-yl]methyl-methylamino]benzonitrile (PubChem CID 99717806) has the molecular formula C19H15F3N4O2 and a molecular weight of 388.35 g/mol. Its IUPAC name is 3-[[(4R)-2,5-dioxo-4-phenyl-4-(trifluoromethyl)imidazolidin-1-yl]methyl-methylamino]benzonitrile.
| Compound Name | 3-[[(4R)-2,5-dioxo-4-phenyl-4-(trifluoromethyl)imidazolidin-1-yl]methyl-methylamino]benzonitrile |
|---|---|
| PubChem CID | 99717806 |
| Molecular Formula | C19H15F3N4O2 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | 3-[[(4R)-2,5-dioxo-4-phenyl-4-(trifluoromethyl)imidazolidin-1-yl]methyl-methylamino]benzonitrile |
| SMILES | CN(CN1C(=O)N[C@@](c2ccccc2)(C(F)(F)F)C1=O)c1cccc(C#N)c1 |
| InChI | InChI=1S/C19H15F3N4O2/c1-25(15-9-5-6-13(10-15)11-23)12-26-16(27)18(19(20,21)22,24-17(26)28)14-7-3-2-4-8-14/h2-10H,12H2,1H3,(H,24,28)/t18-/m1/s1 |
| InChIKey | KHOIGBYIGLOLPZ-GOSISDBHSA-N |
| XLogP | 2.96 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|