C20H16FNO2S3 — CID 997432
(3-fluorophenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone (PubChem CID 997432) has the molecular formula C20H16FNO2S3 and a molecular weight of 417.55 g/mol. Its IUPAC name is (3-fluorophenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone.
| Compound Name | (3-fluorophenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone |
|---|---|
| PubChem CID | 997432 |
| Molecular Formula | C20H16FNO2S3 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.03 |
| IUPAC Name | (3-fluorophenyl)-(6-methoxy-4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)methanone |
| SMILES | COc1cccc2c1N(C(=O)c1cccc(F)c1)C(C)(C)c1ssc(=S)c1-2 |
| InChI | InChI=1S/C20H16FNO2S3/c1-20(2)17-15(19(25)27-26-17)13-8-5-9-14(24-3)16(13)22(20)18(23)11-6-4-7-12(21)10-11/h4-10H,1-3H3 |
| InChIKey | OFYWXUUVDCDTJL-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|