C19H14FNOS3 — CID 1102979
(4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-fluorophenyl)methanone (PubChem CID 1102979) has the molecular formula C19H14FNOS3 and a molecular weight of 387.53 g/mol. Its IUPAC name is (4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-fluorophenyl)methanone.
| Compound Name | (4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-fluorophenyl)methanone |
|---|---|
| PubChem CID | 1102979 |
| Molecular Formula | C19H14FNOS3 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | (4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)-(3-fluorophenyl)methanone |
| SMILES | CC1(C)c2ssc(=S)c2-c2ccccc2N1C(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C19H14FNOS3/c1-19(2)16-15(18(23)25-24-16)13-8-3-4-9-14(13)21(19)17(22)11-6-5-7-12(20)10-11/h3-10H,1-2H3 |
| InChIKey | YPGDUKCXLQQFKD-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|