C21H16N2O2S4 — CID 23906109
2-(1,2-benzoxazol-3-ylsulfanyl)-1-(4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone (PubChem CID 23906109) has the molecular formula C21H16N2O2S4 and a molecular weight of 456.64 g/mol. Its IUPAC name is 2-(1,2-benzoxazol-3-ylsulfanyl)-1-(4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone.
| Compound Name | 2-(1,2-benzoxazol-3-ylsulfanyl)-1-(4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
|---|---|
| PubChem CID | 23906109 |
| Molecular Formula | C21H16N2O2S4 |
| Molecular Weight | 456.64 g/mol |
| Exact Mass | 456.01 |
| IUPAC Name | 2-(1,2-benzoxazol-3-ylsulfanyl)-1-(4,4-dimethyl-1-sulfanylidenedithiolo[3,4-c]quinolin-5-yl)ethanone |
| SMILES | CC1(C)c2ssc(=S)c2-c2ccccc2N1C(=O)CSc1noc2ccccc12 |
| InChI | InChI=1S/C21H16N2O2S4/c1-21(2)18-17(20(26)29-28-18)12-7-3-5-9-14(12)23(21)16(24)11-27-19-13-8-4-6-10-15(13)25-22-19/h3-10H,11H2,1-2H3 |
| InChIKey | OQPRLRKHICUKNG-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 46.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.64 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|