C26H40O4SSi — CID 99772568
methyl (4S,4aR,7R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-5-oxo-7-phenylsulfanyl-2,3,4,6,7,8a-hexahydro-1H-naphthalene-4a-carboxylate (PubChem CID 99772568) has the molecular formula C26H40O4SSi and a molecular weight of 476.76 g/mol. Its IUPAC name is methyl (4S,4aR,7R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-5-oxo-7-phenylsulfanyl-2,3,4,6,7,8a-hexahydro-1H-naphthalene-4a-carboxylate.
| Compound Name | methyl (4S,4aR,7R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-5-oxo-7-phenylsulfanyl-2,3,4,6,7,8a-hexahydro-1H-naphthalene-4a-carboxylate |
|---|---|
| PubChem CID | 99772568 |
| Molecular Formula | C26H40O4SSi |
| Molecular Weight | 476.76 g/mol |
| Exact Mass | 476.24 |
| IUPAC Name | methyl (4S,4aR,7R,8aS)-4-[tert-butyl(dimethyl)silyl]oxy-8,8-dimethyl-5-oxo-7-phenylsulfanyl-2,3,4,6,7,8a-hexahydro-1H-naphthalene-4a-carboxylate |
| SMILES | COC(=O)[C@]12C(=O)C[C@@H](Sc3ccccc3)C(C)(C)[C@H]1CCC[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C26H40O4SSi/c1-24(2,3)32(7,8)30-21-16-12-15-19-25(4,5)22(31-18-13-10-9-11-14-18)17-20(27)26(19,21)23(28)29-6/h9-11,13-14,19,21-22H,12,15-17H2,1-8H3/t19-,21+,22-,26+/m1/s1 |
| InChIKey | CABFEEXBAPFLEM-MRESPNAKSA-N |
| XLogP | 6.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.76 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|