C18H26N2O4 — CID 99781524
(3aS,4aR,8aS)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione (PubChem CID 99781524) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is (3aS,4aR,8aS)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione.
| Compound Name | (3aS,4aR,8aS)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione |
|---|---|
| PubChem CID | 99781524 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | (3aS,4aR,8aS)-2-(1,4-dioxaspiro[4.5]decan-8-yl)-3a,4,4a,5,6,7,8,8a-octahydroimidazo[1,5-a]indole-1,3-dione |
| SMILES | O=C1[C@@H]2C[C@H]3CCCC[C@@H]3N2C(=O)N1C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C18H26N2O4/c21-16-15-11-12-3-1-2-4-14(12)20(15)17(22)19(16)13-5-7-18(8-6-13)23-9-10-24-18/h12-15H,1-11H2/t12-,14+,15+/m1/s1 |
| InChIKey | ZWCWBHHQAPMILR-SNPRPXQTSA-N |
| XLogP | 2.27 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|