C16H22N2O3Si — CID 99796687
(5S)-3-[(4-trimethylsilylphenyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione (PubChem CID 99796687) has the molecular formula C16H22N2O3Si and a molecular weight of 318.45 g/mol. Its IUPAC name is (5S)-3-[(4-trimethylsilylphenyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione.
| Compound Name | (5S)-3-[(4-trimethylsilylphenyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 99796687 |
| Molecular Formula | C16H22N2O3Si |
| Molecular Weight | 318.45 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (5S)-3-[(4-trimethylsilylphenyl)methyl]-7-oxa-1,3-diazaspiro[4.4]nonane-2,4-dione |
| SMILES | C[Si](C)(C)c1ccc(CN2C(=O)N[C@]3(CCOC3)C2=O)cc1 |
| InChI | InChI=1S/C16H22N2O3Si/c1-22(2,3)13-6-4-12(5-7-13)10-18-14(19)16(17-15(18)20)8-9-21-11-16/h4-7H,8-11H2,1-3H3,(H,17,20)/t16-/m0/s1 |
| InChIKey | WNMXDKVLHGTZEI-INIZCTEOSA-N |
| XLogP | 1.44 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.45 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|