C14H15F3N4O — CID 99799726
1-[3-(1H-pyrazol-5-yl)propyl]-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 99799726) has the molecular formula C14H15F3N4O and a molecular weight of 312.29 g/mol. Its IUPAC name is 1-[3-(1H-pyrazol-5-yl)propyl]-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-[3-(1H-pyrazol-5-yl)propyl]-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 99799726 |
| Molecular Formula | C14H15F3N4O |
| Molecular Weight | 312.29 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 1-[3-(1H-pyrazol-5-yl)propyl]-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(NCCCc1ccn[nH]1)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N4O/c15-14(16,17)11-5-1-2-6-12(11)20-13(22)18-8-3-4-10-7-9-19-21-10/h1-2,5-7,9H,3-4,8H2,(H,19,21)(H2,18,20,22) |
| InChIKey | VCVRFSNNMRCZBE-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|