C15H22FNS — CID 99799922
4-[3-(3-fluorophenyl)propyl]-3,3-dimethylthiomorpholine (PubChem CID 99799922) has the molecular formula C15H22FNS and a molecular weight of 267.41 g/mol. Its IUPAC name is 4-[3-(3-fluorophenyl)propyl]-3,3-dimethylthiomorpholine.
| Compound Name | 4-[3-(3-fluorophenyl)propyl]-3,3-dimethylthiomorpholine |
|---|---|
| PubChem CID | 99799922 |
| Molecular Formula | C15H22FNS |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[3-(3-fluorophenyl)propyl]-3,3-dimethylthiomorpholine |
| SMILES | CC1(C)CSCCN1CCCc1cccc(F)c1 |
| InChI | InChI=1S/C15H22FNS/c1-15(2)12-18-10-9-17(15)8-4-6-13-5-3-7-14(16)11-13/h3,5,7,11H,4,6,8-10,12H2,1-2H3 |
| InChIKey | MCZBNXNQCBWIKV-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |