C13H8BrF4N3OS — CID 99810842
(2S)-2-(4-bromo-2-fluorophenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 99810842) has the molecular formula C13H8BrF4N3OS and a molecular weight of 410.19 g/mol. Its IUPAC name is (2S)-2-(4-bromo-2-fluorophenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | (2S)-2-(4-bromo-2-fluorophenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 99810842 |
| Molecular Formula | C13H8BrF4N3OS |
| Molecular Weight | 410.19 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | (2S)-2-(4-bromo-2-fluorophenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | NC(=O)[C@@H](Sc1nccc(C(F)(F)F)n1)c1ccc(Br)cc1F |
| InChI | InChI=1S/C13H8BrF4N3OS/c14-6-1-2-7(8(15)5-6)10(11(19)22)23-12-20-4-3-9(21-12)13(16,17)18/h1-5,10H,(H2,19,22)/t10-/m0/s1 |
| InChIKey | LVJYMZRUAPRHPZ-JTQLQIEISA-N |
| XLogP | 3.72 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.19 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |