C14H14FNO3 — CID 99827046
5-fluoro-2-[2-[(2R)-oxolan-2-yl]ethyl]isoindole-1,3-dione (PubChem CID 99827046) has the molecular formula C14H14FNO3 and a molecular weight of 263.27 g/mol. Its IUPAC name is 5-fluoro-2-[2-[(2R)-oxolan-2-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 5-fluoro-2-[2-[(2R)-oxolan-2-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 99827046 |
| Molecular Formula | C14H14FNO3 |
| Molecular Weight | 263.27 g/mol |
| Exact Mass | 263.10 |
| IUPAC Name | 5-fluoro-2-[2-[(2R)-oxolan-2-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccc(F)cc2C(=O)N1CC[C@H]1CCCO1 |
| InChI | InChI=1S/C14H14FNO3/c15-9-3-4-11-12(8-9)14(18)16(13(11)17)6-5-10-2-1-7-19-10/h3-4,8,10H,1-2,5-7H2/t10-/m1/s1 |
| InChIKey | YVASTAYJVHGXEE-SNVBAGLBSA-N |
| XLogP | 1.99 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.27 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|