C13H21F4N3OS — CID 99828848
(5R)-5-methyl-2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]piperazin-1-yl]-4,5-dihydro-1,3-thiazole (PubChem CID 99828848) has the molecular formula C13H21F4N3OS and a molecular weight of 343.39 g/mol. Its IUPAC name is (5R)-5-methyl-2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]piperazin-1-yl]-4,5-dihydro-1,3-thiazole.
| Compound Name | (5R)-5-methyl-2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]piperazin-1-yl]-4,5-dihydro-1,3-thiazole |
|---|---|
| PubChem CID | 99828848 |
| Molecular Formula | C13H21F4N3OS |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | (5R)-5-methyl-2-[4-[2-(2,2,3,3-tetrafluoropropoxy)ethyl]piperazin-1-yl]-4,5-dihydro-1,3-thiazole |
| SMILES | C[C@@H]1CN=C(N2CCN(CCOCC(F)(F)C(F)F)CC2)S1 |
| InChI | InChI=1S/C13H21F4N3OS/c1-10-8-18-12(22-10)20-4-2-19(3-5-20)6-7-21-9-13(16,17)11(14)15/h10-11H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | PGWWVPPDGIHNIH-SNVBAGLBSA-N |
| XLogP | 2.01 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|