C15H22N2O2S2 — CID 99837386
(1R,5S,7R)-10,10-dimethyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 99837386) has the molecular formula C15H22N2O2S2 and a molecular weight of 326.49 g/mol. Its IUPAC name is (1R,5S,7R)-10,10-dimethyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
| Compound Name | (1R,5S,7R)-10,10-dimethyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
|---|---|
| PubChem CID | 99837386 |
| Molecular Formula | C15H22N2O2S2 |
| Molecular Weight | 326.49 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | (1R,5S,7R)-10,10-dimethyl-4-[(2-methyl-1,3-thiazol-4-yl)methyl]-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| SMILES | Cc1nc(CN2[C@H]3C[C@H]4CC[C@@]3(CS2(=O)=O)C4(C)C)cs1 |
| InChI | InChI=1S/C15H22N2O2S2/c1-10-16-12(8-20-10)7-17-13-6-11-4-5-15(13,14(11,2)3)9-21(17,18)19/h8,11,13H,4-7,9H2,1-3H3/t11-,13+,15+/m1/s1 |
| InChIKey | WOIGNGMXDFHGKD-ZLDLUXBVSA-N |
| XLogP | 2.79 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.49 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |