C18H22N2O2S — CID 91647821
3-[[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methyl]benzonitrile (PubChem CID 91647821) has the molecular formula C18H22N2O2S and a molecular weight of 330.45 g/mol. Its IUPAC name is 3-[[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methyl]benzonitrile.
| Compound Name | 3-[[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 91647821 |
| Molecular Formula | C18H22N2O2S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | 3-[[(1S,5R,7R)-10,10-dimethyl-3,3-dioxo-3λ6-thia-4-azatricyclo[5.2.1.01,5]decan-4-yl]methyl]benzonitrile |
| SMILES | CC1(C)[C@@H]2CC[C@]13CS(=O)(=O)N(Cc1cccc(C#N)c1)[C@@H]3C2 |
| InChI | InChI=1S/C18H22N2O2S/c1-17(2)15-6-7-18(17)12-23(21,22)20(16(18)9-15)11-14-5-3-4-13(8-14)10-19/h3-5,8,15-16H,6-7,9,11-12H2,1-2H3/t15-,16-,18-/m1/s1 |
| InChIKey | FNSDEAZXIQHKEM-JFIYKMOQSA-N |
| XLogP | 2.90 |
| TPSA | 61.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |