C14H20N2O3S — CID 129397758
(1R,5S,7R)-10,10-dimethyl-4-(1,2-oxazol-3-ylmethyl)-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide (PubChem CID 129397758) has the molecular formula C14H20N2O3S and a molecular weight of 296.39 g/mol. Its IUPAC name is (1R,5S,7R)-10,10-dimethyl-4-(1,2-oxazol-3-ylmethyl)-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide.
| Compound Name | (1R,5S,7R)-10,10-dimethyl-4-(1,2-oxazol-3-ylmethyl)-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
|---|---|
| PubChem CID | 129397758 |
| Molecular Formula | C14H20N2O3S |
| Molecular Weight | 296.39 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | (1R,5S,7R)-10,10-dimethyl-4-(1,2-oxazol-3-ylmethyl)-3λ6-thia-4-azatricyclo[5.2.1.01,5]decane 3,3-dioxide |
| SMILES | CC1(C)[C@@H]2CC[C@@]13CS(=O)(=O)N(Cc1ccon1)[C@H]3C2 |
| InChI | InChI=1S/C14H20N2O3S/c1-13(2)10-3-5-14(13)9-20(17,18)16(12(14)7-10)8-11-4-6-19-15-11/h4,6,10,12H,3,5,7-9H2,1-2H3/t10-,12+,14+/m1/s1 |
| InChIKey | OPOAPECAPLYYCZ-OSMZGAPFSA-N |
| XLogP | 2.01 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.39 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |