C18H22N2O4 — CID 99842278
5-cyclopropyl-3-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]-1,2,4-oxadiazole (PubChem CID 99842278) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 5-cyclopropyl-3-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]-1,2,4-oxadiazole.
| Compound Name | 5-cyclopropyl-3-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 99842278 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 5-cyclopropyl-3-[4-[2-[(2S)-oxan-2-yl]oxyethoxy]phenyl]-1,2,4-oxadiazole |
| SMILES | c1cc(-c2noc(C3CC3)n2)ccc1OCCO[C@H]1CCCCO1 |
| InChI | InChI=1S/C18H22N2O4/c1-2-10-22-16(3-1)23-12-11-21-15-8-6-13(7-9-15)17-19-18(24-20-17)14-4-5-14/h6-9,14,16H,1-5,10-12H2/t16-/m0/s1 |
| InChIKey | QHWDSKNXZDRGDA-INIZCTEOSA-N |
| XLogP | 3.54 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|