C15H18N2O5 — CID 66600955
6-[2-(oxan-2-yloxy)ethoxy]imidazo[1,2-a]pyridine-2-carboxylic acid (PubChem CID 66600955) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is 6-[2-(oxan-2-yloxy)ethoxy]imidazo[1,2-a]pyridine-2-carboxylic acid.
| Compound Name | 6-[2-(oxan-2-yloxy)ethoxy]imidazo[1,2-a]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 66600955 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 6-[2-(oxan-2-yloxy)ethoxy]imidazo[1,2-a]pyridine-2-carboxylic acid |
| SMILES | O=C(O)c1cn2cc(OCCOC3CCCCO3)ccc2n1 |
| InChI | InChI=1S/C15H18N2O5/c18-15(19)12-10-17-9-11(4-5-13(17)16-12)20-7-8-22-14-3-1-2-6-21-14/h4-5,9-10,14H,1-3,6-8H2,(H,18,19) |
| InChIKey | DRSXOSVGZLXUAU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 82.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|