C23H28N2O8 — CID 10434389
6-[1-(6-carboxy-2-pyridinyl)-1-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl]pyridine-2-carboxylic acid (PubChem CID 10434389) has the molecular formula C23H28N2O8 and a molecular weight of 460.48 g/mol. Its IUPAC name is 6-[1-(6-carboxy-2-pyridinyl)-1-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl]pyridine-2-carboxylic acid.
| Compound Name | 6-[1-(6-carboxy-2-pyridinyl)-1-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl]pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 10434389 |
| Molecular Formula | C23H28N2O8 |
| Molecular Weight | 460.48 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 6-[1-(6-carboxy-2-pyridinyl)-1-[2-[2-(oxan-2-yloxy)ethoxy]ethoxy]ethyl]pyridine-2-carboxylic acid |
| SMILES | CC(OCCOCCOC1CCCCO1)(c1cccc(C(=O)O)n1)c1cccc(C(=O)O)n1 |
| InChI | InChI=1S/C23H28N2O8/c1-23(18-8-4-6-16(24-18)21(26)27,19-9-5-7-17(25-19)22(28)29)33-15-13-30-12-14-32-20-10-2-3-11-31-20/h4-9,20H,2-3,10-15H2,1H3,(H,26,27)(H,28,29) |
| InChIKey | SFVQDIHNJCMURF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 137.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.48 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|