C15H22ClNO3S — CID 99851290
(3R)-N-[(2R)-2-(2-chlorophenoxy)butyl]-1,1-dioxothian-3-amine (PubChem CID 99851290) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is (3R)-N-[(2R)-2-(2-chlorophenoxy)butyl]-1,1-dioxothian-3-amine.
| Compound Name | (3R)-N-[(2R)-2-(2-chlorophenoxy)butyl]-1,1-dioxothian-3-amine |
|---|---|
| PubChem CID | 99851290 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (3R)-N-[(2R)-2-(2-chlorophenoxy)butyl]-1,1-dioxothian-3-amine |
| SMILES | CC[C@H](CN[C@@H]1CCCS(=O)(=O)C1)Oc1ccccc1Cl |
| InChI | InChI=1S/C15H22ClNO3S/c1-2-13(20-15-8-4-3-7-14(15)16)10-17-12-6-5-9-21(18,19)11-12/h3-4,7-8,12-13,17H,2,5-6,9-11H2,1H3/t12-,13-/m1/s1 |
| InChIKey | HJKMKTIOPNQAAW-CHWSQXEVSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |