C15H14N4S — CID 99897467
(5S,6S)-6-pyridin-2-yl-5-pyridin-4-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole (PubChem CID 99897467) has the molecular formula C15H14N4S and a molecular weight of 282.37 g/mol. Its IUPAC name is (5S,6S)-6-pyridin-2-yl-5-pyridin-4-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole.
| Compound Name | (5S,6S)-6-pyridin-2-yl-5-pyridin-4-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
|---|---|
| PubChem CID | 99897467 |
| Molecular Formula | C15H14N4S |
| Molecular Weight | 282.37 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (5S,6S)-6-pyridin-2-yl-5-pyridin-4-yl-2,3,5,6-tetrahydroimidazo[2,1-b][1,3]thiazole |
| SMILES | c1ccc([C@H]2N=C3SCCN3[C@H]2c2ccncc2)nc1 |
| InChI | InChI=1S/C15H14N4S/c1-2-6-17-12(3-1)13-14(11-4-7-16-8-5-11)19-9-10-20-15(19)18-13/h1-8,13-14H,9-10H2/t13-,14+/m1/s1 |
| InChIKey | CWBDPDMNWZUYJJ-KGLIPLIRSA-N |
| XLogP | 2.68 |
| TPSA | 41.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.37 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |