C14H14Cl2N2O4S2 — CID 99991927
3-[(3S)-1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 99991927) has the molecular formula C14H14Cl2N2O4S2 and a molecular weight of 409.32 g/mol. Its IUPAC name is 3-[(3S)-1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[(3S)-1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 99991927 |
| Molecular Formula | C14H14Cl2N2O4S2 |
| Molecular Weight | 409.32 g/mol |
| Exact Mass | 407.98 |
| IUPAC Name | 3-[(3S)-1-(2,4-dichloro-5-methylphenyl)sulfonylpyrrolidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | Cc1cc(S(=O)(=O)N2CC[C@H](N3C(=O)CSC3=O)C2)c(Cl)cc1Cl |
| InChI | InChI=1S/C14H14Cl2N2O4S2/c1-8-4-12(11(16)5-10(8)15)24(21,22)17-3-2-9(6-17)18-13(19)7-23-14(18)20/h4-5,9H,2-3,6-7H2,1H3/t9-/m0/s1 |
| InChIKey | BYCUPWBLAJGCTH-VIFPVBQESA-N |
| XLogP | 2.76 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|