C12H10Cl2N2O4S2 — CID 121155376
3-[1-(2,6-dichlorophenyl)sulfonylazetidin-3-yl]-1,3-thiazolidine-2,4-dione (PubChem CID 121155376) has the molecular formula C12H10Cl2N2O4S2 and a molecular weight of 381.26 g/mol. Its IUPAC name is 3-[1-(2,6-dichlorophenyl)sulfonylazetidin-3-yl]-1,3-thiazolidine-2,4-dione.
| Compound Name | 3-[1-(2,6-dichlorophenyl)sulfonylazetidin-3-yl]-1,3-thiazolidine-2,4-dione |
|---|---|
| PubChem CID | 121155376 |
| Molecular Formula | C12H10Cl2N2O4S2 |
| Molecular Weight | 381.26 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | 3-[1-(2,6-dichlorophenyl)sulfonylazetidin-3-yl]-1,3-thiazolidine-2,4-dione |
| SMILES | O=C1CSC(=O)N1C1CN(S(=O)(=O)c2c(Cl)cccc2Cl)C1 |
| InChI | InChI=1S/C12H10Cl2N2O4S2/c13-8-2-1-3-9(14)11(8)22(19,20)15-4-7(5-15)16-10(17)6-21-12(16)18/h1-3,7H,4-6H2 |
| InChIKey | MXYFIVVAGHKGBE-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|