C8H5N3O3S2 — CID 19646
View drug profile → tenonitrozoleN-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide (PubChem CID 19646) has the molecular formula C8H5N3O3S2 and a molecular weight of 255.28 g/mol. Its IUPAC name is N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide.
| Compound Name | N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 19646 |
| Molecular Formula | C8H5N3O3S2 |
| Molecular Weight | 255.28 g/mol |
| Exact Mass | 254.98 |
| IUPAC Name | N-(5-nitro-1,3-thiazol-2-yl)thiophene-2-carboxamide |
| SMILES | O=C(Nc1ncc([N+](=O)[O-])s1)c1cccs1 |
| InChI | InChI=1S/C8H5N3O3S2/c12-7(5-2-1-3-15-5)10-8-9-4-6(16-8)11(13)14/h1-4H,(H,9,10,12) |
| InChIKey | ZLOXYEZYWCTXHU-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 85.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|