About butylurea
butylurea (PubChem CID 11595) has the molecular formula C5H12N2O
and a molecular weight of 116.16 g/mol. Its IUPAC name is butylurea.
Molecular Properties
| Compound Name | butylurea |
| PubChem CID | 11595 |
| Molecular Formula | C5H12N2O |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.09 |
| IUPAC Name | butylurea |
| SMILES | CCCCNC(N)=O |
| InChI | InChI=1S/C5H12N2O/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H3,6,7,8) |
| InChIKey | CNWSQCLBDWYLAN-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butylurea?
The IUPAC name of butylurea (CID 11595) is butylurea.
What is the SMILES notation for butylurea?
The canonical SMILES for butylurea is CCCCNC(N)=O.
What is the InChIKey of butylurea?
The InChIKey is CNWSQCLBDWYLAN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12N2O/c1-2-3-4-7-5(6)8/h2-4H2,1H3,(H3,6,7,8).
What are the key properties of butylurea?
butylurea has a molecular weight of 116.16 g/mol, XLogP of 0.45, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butylurea is sourced from PubChem (CID 11595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).