C14H19N5O4 — CID 3324
View drug profile → famciclovir[2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)butyl] acetate (PubChem CID 3324) has the molecular formula C14H19N5O4 and a molecular weight of 321.34 g/mol. Its IUPAC name is [2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)butyl] acetate.
| Compound Name | [2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)butyl] acetate |
|---|---|
| PubChem CID | 3324 |
| Molecular Formula | C14H19N5O4 |
| Molecular Weight | 321.34 g/mol |
| Exact Mass | 321.14 |
| IUPAC Name | [2-(acetyloxymethyl)-4-(2-aminopurin-9-yl)butyl] acetate |
| SMILES | CC(=O)OCC(CCn1cnc2cnc(N)nc21)COC(C)=O |
| InChI | InChI=1S/C14H19N5O4/c1-9(20)22-6-11(7-23-10(2)21)3-4-19-8-17-12-5-16-14(15)18-13(12)19/h5,8,11H,3-4,6-7H2,1-2H3,(H2,15,16,18) |
| InChIKey | GGXKWVWZWMLJEH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 122.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.34 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |