C18H22O3 — CID 10599
View drug profile → methallenestril3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoic acid (PubChem CID 10599) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoic acid.
| Compound Name | 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 10599 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 3-(6-methoxynaphthalen-2-yl)-2,2-dimethylpentanoic acid |
| SMILES | CCC(c1ccc2cc(OC)ccc2c1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C18H22O3/c1-5-16(18(2,3)17(19)20)14-7-6-13-11-15(21-4)9-8-12(13)10-14/h6-11,16H,5H2,1-4H3,(H,19,20) |
| InChIKey | KHLJKRBMZVNZOC-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |