C14H12O — CID 174999308
octalen-2-ol (PubChem CID 174999308) has the molecular formula C14H12O and a molecular weight of 196.25 g/mol. Its IUPAC name is octalen-2-ol.
| Compound Name | octalen-2-ol |
|---|---|
| PubChem CID | 174999308 |
| Molecular Formula | C14H12O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | octalen-2-ol |
| SMILES | Oc1ccccc2ccccccc-2c1 |
| InChI | InChI=1S/C14H12O/c15-14-10-6-5-8-12-7-3-1-2-4-9-13(12)11-14/h1-11,15H/b2-1-,3-1-,4-2-,6-5-,7-3-,8-5-,9-4-,10-6-,12-7-,12-8-,13-9-,13-11-,13-12-,14-10+,14-11+ |
| InChIKey | AMHVVELGRZTYAA-OOHWFZALSA-N |
| XLogP | 3.62 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |